5-Hydroxyferulic acid

5-Hydroxyferulic acid

Names
IUPAC name (E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
Identifiers
CAS Number	1782-55-4
ChemSpider	394087
Jmol 3D model	Interactive image
PubChem	446834
InChI InChI=1S/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/b3-2+ Key: YFXWTVLDSKSYLW-NSCUHMNNSA-N InChI=1/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/b3-2+ Key: YFXWTVLDSKSYLW-NSCUHMNNBP
SMILES O=C(O)\C=C\c1cc(O)c(O)c(OC)c1
Properties
Chemical formula	C10H10O5
Molar mass	210.18 g/mol
Vapor pressure	{{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

5-Hydroxyferulic acid is a hydroxycinnamic acid.

It is a precursor in the biosynthesis of sinapic acid. Phenylalanine is first converted to cinnamic acid by the action of the enzyme phenylalanine ammonia-lyase (PAL). A series of enzymatic hydroxylations and methylations leads to coumaric acid, caffeic acid, ferulic acid, 5-hydroxyferulic acid and sinapic acid.

Thus 5-hydroxyferulic acid is formed from ferulic acid by the action of the specific enzyme ferulate 5-hydroxylase (F5H).