Caesium bicarbonate

Caesium bicarbonate

150px
Names
IUPAC name Caesium bicarbonate
Other names Cesium bicarbonate
Identifiers
CAS Number	15519-28-5
ChemSpider	2006316
Jmol 3D model	Interactive image
PubChem	2724157
InChI InChI=1S/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 Key: ZMCUDHNSHCRDBT-UHFFFAOYSA-M InChI=1/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 Key: ZMCUDHNSHCRDBT-REWHXWOFAQ
SMILES [Cs+].[O-]C(=O)O
Properties
Chemical formula	CsHCO3
Molar mass	193.922 g/mol
Vapor pressure	{{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Caesium bicarbonate is a chemical compound with the chemical formula CsHCO₃. It can be produced through the following reaction:

Cs₂CO₃ + CO₂ + H₂O → 2 CsHCO₃

The compound can be used for synthesizing caesium salts, but less common than caesium carbonate.