Xylonic acid

D-Xylonic acid

Names
IUPAC name (2R,3S,4R)-2,3,4,5-tetrahydroxypentanoic acid
Other names Lyxonic acid; Xylonate
Identifiers
CAS Number	17828-56-7 (D/L) Y 526-91-0 (D) N 4172-44-5 (L) N
ChemSpider	5034782 N
Jmol 3D model	Interactive image
PubChem	6602431
InChI InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4-/m1/s1 N Key: QXKAIJAYHKCRRA-FLRLBIABSA-N N InChI=1/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4-/m1/s1 Key: QXKAIJAYHKCRRA-FLRLBIABBX
SMILES C([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O
Properties
Chemical formula	C 5H 10O 6
Molar mass	166.13 g/mol
Vapor pressure	{{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify (what is YN ?)
Infobox references

Xylonic acid /zaɪˈlɒnɪk æ.sɪd/ is a sugar acid that can be obtained by the complete oxidation of xylose (a primary alcohol).